C14H14F3N5O2 — CID 21472087
3-azido-5-propan-2-yl-1-(2,2,2-trifluoroethyl)-1,5-benzodiazepine-2,4-dione (PubChem CID 21472087) has the molecular formula C14H14F3N5O2 and a molecular weight of 341.29 g/mol. Its IUPAC name is 3-azido-5-propan-2-yl-1-(2,2,2-trifluoroethyl)-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3-azido-5-propan-2-yl-1-(2,2,2-trifluoroethyl)-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 21472087 |
| Molecular Formula | C14H14F3N5O2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-azido-5-propan-2-yl-1-(2,2,2-trifluoroethyl)-1,5-benzodiazepine-2,4-dione |
| SMILES | CC(C)N1C(=O)C(N=[N+]=[N-])C(=O)N(CC(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C14H14F3N5O2/c1-8(2)22-10-6-4-3-5-9(10)21(7-14(15,16)17)12(23)11(13(22)24)19-20-18/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | DDRVHSGLPRAZEE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 89.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|