C16H22N2O — CID 21366328
3-tert-butyl-1-propan-2-yl-3H-1,4-benzodiazepin-2-one (PubChem CID 21366328) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 3-tert-butyl-1-propan-2-yl-3H-1,4-benzodiazepin-2-one.
| Compound Name | 3-tert-butyl-1-propan-2-yl-3H-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 21366328 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 3-tert-butyl-1-propan-2-yl-3H-1,4-benzodiazepin-2-one |
| SMILES | CC(C)N1C(=O)C(C(C)(C)C)N=Cc2ccccc21 |
| InChI | InChI=1S/C16H22N2O/c1-11(2)18-13-9-7-6-8-12(13)10-17-14(15(18)19)16(3,4)5/h6-11,14H,1-5H3 |
| InChIKey | QFVOESUWRSBKHA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |