About 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane
2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 122534447) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane.
Analyze 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane (CID 122534447) is 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane is CN1CC2N(C)CC1C2(C)C.
What is the InChIKey of 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is IIFDDECJODVENH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-9(2)7-6-11(4)8(9)5-10(7)3/h7-8H,5-6H2,1-4H3.
What are the key properties of 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane?
2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 154.26 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5,7,7-tetramethyl-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 122534447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).