C8H14N2 — CID 123781299
3,7-dimethyl-3,6-diazatricyclo[3.2.1.02,7]octane (PubChem CID 123781299) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 3,7-dimethyl-3,6-diazatricyclo[3.2.1.02,7]octane.
| Compound Name | 3,7-dimethyl-3,6-diazatricyclo[3.2.1.02,7]octane |
|---|---|
| PubChem CID | 123781299 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 3,7-dimethyl-3,6-diazatricyclo[3.2.1.02,7]octane |
| SMILES | CN1CC2CC3C1C3(C)N2 |
| InChI | InChI=1S/C8H14N2/c1-8-6-3-5(9-8)4-10(2)7(6)8/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | VMHONENJVOXTPL-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |