C14H27NO — CID 122535024
1-(4,5-ditert-butylpyrrolidin-2-yl)ethanone (PubChem CID 122535024) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 1-(4,5-ditert-butylpyrrolidin-2-yl)ethanone.
| Compound Name | 1-(4,5-ditert-butylpyrrolidin-2-yl)ethanone |
|---|---|
| PubChem CID | 122535024 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 1-(4,5-ditert-butylpyrrolidin-2-yl)ethanone |
| SMILES | CC(=O)C1CC(C(C)(C)C)C(C(C)(C)C)N1 |
| InChI | InChI=1S/C14H27NO/c1-9(16)11-8-10(13(2,3)4)12(15-11)14(5,6)7/h10-12,15H,8H2,1-7H3 |
| InChIKey | FGQVDVWSVWVTNJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |