C8H13NO — CID 142076983
1-[(1R,4S)-3-azabicyclo[4.1.0]heptan-4-yl]ethanone (PubChem CID 142076983) has the molecular formula C8H13NO and a molecular weight of 139.20 g/mol. Its IUPAC name is 1-[(1R,4S)-3-azabicyclo[4.1.0]heptan-4-yl]ethanone.
| Compound Name | 1-[(1R,4S)-3-azabicyclo[4.1.0]heptan-4-yl]ethanone |
|---|---|
| PubChem CID | 142076983 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 1-[(1R,4S)-3-azabicyclo[4.1.0]heptan-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1CC2C[C@H]2CN1 |
| InChI | InChI=1S/C8H13NO/c1-5(10)8-3-6-2-7(6)4-9-8/h6-9H,2-4H2,1H3/t6?,7-,8-/m0/s1 |
| InChIKey | FXGAKGLANYOXNL-ALKRTJFJSA-N |
| XLogP | 0.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |