C9H17NOS — CID 59050222
1-[(4S)-2-tert-butyl-1,3-thiazolidin-4-yl]ethanone (PubChem CID 59050222) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 1-[(4S)-2-tert-butyl-1,3-thiazolidin-4-yl]ethanone.
| Compound Name | 1-[(4S)-2-tert-butyl-1,3-thiazolidin-4-yl]ethanone |
|---|---|
| PubChem CID | 59050222 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 1-[(4S)-2-tert-butyl-1,3-thiazolidin-4-yl]ethanone |
| SMILES | CC(=O)[C@H]1CSC(C(C)(C)C)N1 |
| InChI | InChI=1S/C9H17NOS/c1-6(11)7-5-12-8(10-7)9(2,3)4/h7-8,10H,5H2,1-4H3/t7-,8?/m1/s1 |
| InChIKey | CCNQHGKVNOBCMR-GVHYBUMESA-N |
| XLogP | 1.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |