C14H25NO2S — CID 65171330
methyl 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylate (PubChem CID 65171330) has the molecular formula C14H25NO2S and a molecular weight of 271.43 g/mol. Its IUPAC name is methyl 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylate.
| Compound Name | methyl 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylate |
|---|---|
| PubChem CID | 65171330 |
| Molecular Formula | C14H25NO2S |
| Molecular Weight | 271.43 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | methyl 7-tert-butyl-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[b][1,4]thiazine-3-carboxylate |
| SMILES | COC(=O)C1CSC2CC(C(C)(C)C)CCC2N1 |
| InChI | InChI=1S/C14H25NO2S/c1-14(2,3)9-5-6-10-12(7-9)18-8-11(15-10)13(16)17-4/h9-12,15H,5-8H2,1-4H3 |
| InChIKey | DHPQRLLDEVGSLL-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |