C24H28F3N3O5S — CID 122535508
tert-butyl (6S)-6-[5-[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-4-yl]-1H-imidazol-2-yl]-5-azaspiro[2.4]heptane-5-carboxylate (PubChem CID 122535508) has the molecular formula C24H28F3N3O5S and a molecular weight of 527.57 g/mol. Its IUPAC name is tert-butyl (6S)-6-[5-[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-4-yl]-1H-imidazol-2-yl]-5-azaspiro[2.4]heptane-5-carboxylate.
| Compound Name | tert-butyl (6S)-6-[5-[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-4-yl]-1H-imidazol-2-yl]-5-azaspiro[2.4]heptane-5-carboxylate |
|---|---|
| PubChem CID | 122535508 |
| Molecular Formula | C24H28F3N3O5S |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | tert-butyl (6S)-6-[5-[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-4-yl]-1H-imidazol-2-yl]-5-azaspiro[2.4]heptane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@H]1c1ncc(-c2ccc(OS(=O)(=O)C(F)(F)F)c3c2CCC3)[nH]1 |
| InChI | InChI=1S/C24H28F3N3O5S/c1-22(2,3)34-21(31)30-13-23(9-10-23)11-18(30)20-28-12-17(29-20)15-7-8-19(16-6-4-5-14(15)16)35-36(32,33)24(25,26)27/h7-8,12,18H,4-6,9-11,13H2,1-3H3,(H,28,29)/t18-/m0/s1 |
| InChIKey | IMHMCQUGDDZOPS-SFHVURJKSA-N |
| XLogP | 5.26 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|