C32H36F3N3O5S — CID 126580902
tert-butyl (2S,4S)-4-ethyl-2-[5-[4-[6-(trifluoromethylsulfonyloxy)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 126580902) has the molecular formula C32H36F3N3O5S and a molecular weight of 631.72 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-ethyl-2-[5-[4-[6-(trifluoromethylsulfonyloxy)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-4-ethyl-2-[5-[4-[6-(trifluoromethylsulfonyloxy)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 126580902 |
| Molecular Formula | C32H36F3N3O5S |
| Molecular Weight | 631.72 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | tert-butyl (2S,4S)-4-ethyl-2-[5-[4-[6-(trifluoromethylsulfonyloxy)-3-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl]phenyl]-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC[C@H]1C[C@@H](c2ncc(-c3ccc(-c4ccc(OS(=O)(=O)C(F)(F)F)c5c4C4CCC5C4)cc3)[nH]2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C32H36F3N3O5S/c1-5-18-14-25(38(17-18)30(39)42-31(2,3)4)29-36-16-24(37-29)20-8-6-19(7-9-20)23-12-13-26(43-44(40,41)32(33,34)35)28-22-11-10-21(15-22)27(23)28/h6-9,12-13,16,18,21-22,25H,5,10-11,14-15,17H2,1-4H3,(H,36,37)/t18-,21?,22?,25-/m0/s1 |
| InChIKey | AFAUKRGQCPPVJK-VODJVRFHSA-N |
| XLogP | 8.04 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.72 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|