C21H29F2N3O2Si — CID 67992849
tert-butyl (2S)-4,4-difluoro-2-[5-(4-trimethylsilylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate (PubChem CID 67992849) has the molecular formula C21H29F2N3O2Si and a molecular weight of 421.56 g/mol. Its IUPAC name is tert-butyl (2S)-4,4-difluoro-2-[5-(4-trimethylsilylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-4,4-difluoro-2-[5-(4-trimethylsilylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 67992849 |
| Molecular Formula | C21H29F2N3O2Si |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | tert-butyl (2S)-4,4-difluoro-2-[5-(4-trimethylsilylphenyl)-1H-imidazol-2-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(F)(F)C[C@H]1c1ncc(-c2ccc([Si](C)(C)C)cc2)[nH]1 |
| InChI | InChI=1S/C21H29F2N3O2Si/c1-20(2,3)28-19(27)26-13-21(22,23)11-17(26)18-24-12-16(25-18)14-7-9-15(10-8-14)29(4,5)6/h7-10,12,17H,11,13H2,1-6H3,(H,24,25)/t17-/m0/s1 |
| InChIKey | WHLGJLBULRQSQS-KRWDZBQOSA-N |
| XLogP | 4.94 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|