C20H22F2N8O — CID 122536071
5-[4-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine (PubChem CID 122536071) has the molecular formula C20H22F2N8O and a molecular weight of 428.45 g/mol. Its IUPAC name is 5-[4-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122536071 |
| Molecular Formula | C20H22F2N8O |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 5-[4-(6,6-difluoro-3-azabicyclo[3.2.0]heptan-3-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC4CC(F)(F)C4C3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C20H22F2N8O/c1-19(2)17-26-13-15(29-8-10-5-20(21,22)12(10)9-29)27-14(11-6-24-18(23)25-7-11)28-16(13)30(17)3-4-31-19/h6-7,10,12H,3-5,8-9H2,1-2H3,(H2,23,24,25) |
| InChIKey | KCWGOODHWBOPAM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |