C23H29FN8O — CID 167028507
5-[4-[(3aS,6aS)-4-ethyl-4-fluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine (PubChem CID 167028507) has the molecular formula C23H29FN8O and a molecular weight of 452.54 g/mol. Its IUPAC name is 5-[4-[(3aS,6aS)-4-ethyl-4-fluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-[(3aS,6aS)-4-ethyl-4-fluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 167028507 |
| Molecular Formula | C23H29FN8O |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | 5-[4-[(3aS,6aS)-4-ethyl-4-fluoro-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
| SMILES | CCC1(F)CC[C@@H]2CN(c3nc(-c4cnc(N)nc4)nc4c3nc3n4CCOC3(C)C)C[C@H]21 |
| InChI | InChI=1S/C23H29FN8O/c1-4-23(24)6-5-13-11-31(12-15(13)23)18-16-19(32-7-8-33-22(2,3)20(32)28-16)30-17(29-18)14-9-26-21(25)27-10-14/h9-10,13,15H,4-8,11-12H2,1-3H3,(H2,25,26,27)/t13-,15-,23?/m1/s1 |
| InChIKey | SAHOXIOPLYHYMB-GLWFPNFASA-N |
| XLogP | 3.10 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |