C22H26N8O — CID 167028470
5-[4-(6-azatricyclo[3.2.2.02,4]nonan-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine (PubChem CID 167028470) has the molecular formula C22H26N8O and a molecular weight of 418.51 g/mol. Its IUPAC name is 5-[4-(6-azatricyclo[3.2.2.02,4]nonan-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine.
| Compound Name | 5-[4-(6-azatricyclo[3.2.2.02,4]nonan-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 167028470 |
| Molecular Formula | C22H26N8O |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 5-[4-(6-azatricyclo[3.2.2.02,4]nonan-6-yl)-6,6-dimethyl-8,9-dihydropurino[8,9-c][1,4]oxazin-2-yl]pyrimidin-2-amine |
| SMILES | CC1(C)OCCn2c1nc1c(N3CC4CCC3C3CC43)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C22H26N8O/c1-22(2)20-26-16-18(29(20)5-6-31-22)27-17(12-8-24-21(23)25-9-12)28-19(16)30-10-11-3-4-15(30)14-7-13(11)14/h8-9,11,13-15H,3-7,10H2,1-2H3,(H2,23,24,25) |
| InChIKey | UXTAGEYYYWUVNP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |