C21H31F2IO2 — CID 122536213
2,3-difluoro-1-[[4-(4-iodoheptyl)cyclohexyl]methoxy]-4-methoxybenzene (PubChem CID 122536213) has the molecular formula C21H31F2IO2 and a molecular weight of 480.38 g/mol. Its IUPAC name is 2,3-difluoro-1-[[4-(4-iodoheptyl)cyclohexyl]methoxy]-4-methoxybenzene.
| Compound Name | 2,3-difluoro-1-[[4-(4-iodoheptyl)cyclohexyl]methoxy]-4-methoxybenzene |
|---|---|
| PubChem CID | 122536213 |
| Molecular Formula | C21H31F2IO2 |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | 2,3-difluoro-1-[[4-(4-iodoheptyl)cyclohexyl]methoxy]-4-methoxybenzene |
| SMILES | CCCC(I)CCCC1CCC(COc2ccc(OC)c(F)c2F)CC1 |
| InChI | InChI=1S/C21H31F2IO2/c1-3-5-17(24)7-4-6-15-8-10-16(11-9-15)14-26-19-13-12-18(25-2)20(22)21(19)23/h12-13,15-17H,3-11,14H2,1-2H3 |
| InChIKey | FIKOGAPBNAXZJN-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|