C8H13FO3 — CID 122537173
(2S,3S,4S,5R)-5-ethenyl-4-fluoro-5-(hydroxymethyl)-2-methyloxolan-3-ol (PubChem CID 122537173) has the molecular formula C8H13FO3 and a molecular weight of 176.19 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-ethenyl-4-fluoro-5-(hydroxymethyl)-2-methyloxolan-3-ol.
| Compound Name | (2S,3S,4S,5R)-5-ethenyl-4-fluoro-5-(hydroxymethyl)-2-methyloxolan-3-ol |
|---|---|
| PubChem CID | 122537173 |
| Molecular Formula | C8H13FO3 |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (2S,3S,4S,5R)-5-ethenyl-4-fluoro-5-(hydroxymethyl)-2-methyloxolan-3-ol |
| SMILES | C=C[C@]1(CO)O[C@@H](C)[C@H](O)[C@@H]1F |
| InChI | InChI=1S/C8H13FO3/c1-3-8(4-10)7(9)6(11)5(2)12-8/h3,5-7,10-11H,1,4H2,2H3/t5-,6-,7-,8+/m0/s1 |
| InChIKey | CPEPXJBVXRTNJX-DKXJUACHSA-N |
| XLogP | 0.02 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|