C14H13N3 — CID 122537360
10-methyl-1,4,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene (PubChem CID 122537360) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 10-methyl-1,4,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene.
| Compound Name | 10-methyl-1,4,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene |
|---|---|
| PubChem CID | 122537360 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 10-methyl-1,4,10-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-2(7),3,5,11,13,15-hexaene |
| SMILES | CN1c2ccccc2N2c3cnccc3CC12 |
| InChI | InChI=1S/C14H13N3/c1-16-11-4-2-3-5-12(11)17-13-9-15-7-6-10(13)8-14(16)17/h2-7,9,14H,8H2,1H3 |
| InChIKey | WQNKOCFDOAGGBQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |