C19H30N4O4 — CID 122538916
4-methyl-2-[[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]methylamino]pentanoic acid (PubChem CID 122538916) has the molecular formula C19H30N4O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is 4-methyl-2-[[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]methylamino]pentanoic acid.
| Compound Name | 4-methyl-2-[[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]methylamino]pentanoic acid |
|---|---|
| PubChem CID | 122538916 |
| Molecular Formula | C19H30N4O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-methyl-2-[[4-[(1-methylpiperidin-4-yl)amino]-3-nitrophenyl]methylamino]pentanoic acid |
| SMILES | CC(C)CC(NCc1ccc(NC2CCN(C)CC2)c([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C19H30N4O4/c1-13(2)10-17(19(24)25)20-12-14-4-5-16(18(11-14)23(26)27)21-15-6-8-22(3)9-7-15/h4-5,11,13,15,17,20-21H,6-10,12H2,1-3H3,(H,24,25) |
| InChIKey | MNABLGFESLKTEI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|