C24H40N4O4 — CID 126737357
tert-butyl N-[4-[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]cyclohexyl]carbamate (PubChem CID 126737357) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 126737357 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | tert-butyl N-[4-[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]cyclohexyl]carbamate |
| SMILES | C[C@H](NCc1ccc(NC2CCC(NC(=O)OC(C)(C)C)CC2)c([N+](=O)[O-])c1)C(C)(C)C |
| InChI | InChI=1S/C24H40N4O4/c1-16(23(2,3)4)25-15-17-8-13-20(21(14-17)28(30)31)26-18-9-11-19(12-10-18)27-22(29)32-24(5,6)7/h8,13-14,16,18-19,25-26H,9-12,15H2,1-7H3,(H,27,29)/t16-,18?,19?/m0/s1 |
| InChIKey | RLDZBIHTJCAZSH-IVMQYODDSA-N |
| XLogP | 5.37 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|