C23H38N4O4 — CID 90044939
2-tert-butyl-2-[[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid (PubChem CID 90044939) has the molecular formula C23H38N4O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-tert-butyl-2-[[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-2-[[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 90044939 |
| Molecular Formula | C23H38N4O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.29 |
| IUPAC Name | 2-tert-butyl-2-[[4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-2-nitroanilino]methyl]pyrrolidine-1-carboxylic acid |
| SMILES | C[C@H](NCc1ccc(NCC2(C(C)(C)C)CCCN2C(=O)O)c([N+](=O)[O-])c1)C(C)(C)C |
| InChI | InChI=1S/C23H38N4O4/c1-16(21(2,3)4)24-14-17-9-10-18(19(13-17)27(30)31)25-15-23(22(5,6)7)11-8-12-26(23)20(28)29/h9-10,13,16,24-25H,8,11-12,14-15H2,1-7H3,(H,28,29)/t16-,23?/m0/s1 |
| InChIKey | SZYUNFLMFTZQSV-GZWBLTSWSA-N |
| XLogP | 5.09 |
| TPSA | 107.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|