C13H7F6IO — CID 122541366
1,1,1,3,3,3-hexafluoro-2-(4-iodonaphthalen-1-yl)propan-2-ol (PubChem CID 122541366) has the molecular formula C13H7F6IO and a molecular weight of 420.09 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-(4-iodonaphthalen-1-yl)propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-(4-iodonaphthalen-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 122541366 |
| Molecular Formula | C13H7F6IO |
| Molecular Weight | 420.09 g/mol |
| Exact Mass | 419.94 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-(4-iodonaphthalen-1-yl)propan-2-ol |
| SMILES | OC(c1ccc(I)c2ccccc12)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H7F6IO/c14-12(15,16)11(21,13(17,18)19)9-5-6-10(20)8-4-2-1-3-7(8)9/h1-6,21H |
| InChIKey | OYHBSXZOPVFHAV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.09 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|