C12H16FN2O13P3 — CID 122543158
[[(2R,4S,5S)-4-fluoro-3-hydroxy-5-(6-oxo-2-prop-1-ynyl-1H-pyrazin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543158) has the molecular formula C12H16FN2O13P3 and a molecular weight of 508.18 g/mol. Its IUPAC name is [[(2R,4S,5S)-4-fluoro-3-hydroxy-5-(6-oxo-2-prop-1-ynyl-1H-pyrazin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5S)-4-fluoro-3-hydroxy-5-(6-oxo-2-prop-1-ynyl-1H-pyrazin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543158 |
| Molecular Formula | C12H16FN2O13P3 |
| Molecular Weight | 508.18 g/mol |
| Exact Mass | 507.98 |
| IUPAC Name | [[(2R,4S,5S)-4-fluoro-3-hydroxy-5-(6-oxo-2-prop-1-ynyl-1H-pyrazin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | CC#Cc1[nH]c(=O)cnc1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)[C@@H]1F |
| InChI | InChI=1S/C12H16FN2O13P3/c1-2-3-6-10(14-4-8(16)15-6)12-9(13)11(17)7(26-12)5-25-30(21,22)28-31(23,24)27-29(18,19)20/h4,7,9,11-12,17H,5H2,1H3,(H,15,16)(H,21,22)(H,23,24)(H2,18,19,20)/t7-,9+,11?,12-/m1/s1 |
| InChIKey | XUQALQSFSKSMIE-DLDKZQDRSA-N |
| XLogP | -0.38 |
| TPSA | 235.03 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.18 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|