C14H18FN2O14P3 — CID 122543294
[[(2R,3R,5S)-5-(6-fluoro-5-methyl-2-oxo-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543294) has the molecular formula C14H18FN2O14P3 and a molecular weight of 550.22 g/mol. Its IUPAC name is [[(2R,3R,5S)-5-(6-fluoro-5-methyl-2-oxo-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5S)-5-(6-fluoro-5-methyl-2-oxo-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543294 |
| Molecular Formula | C14H18FN2O14P3 |
| Molecular Weight | 550.22 g/mol |
| Exact Mass | 550.00 |
| IUPAC Name | [[(2R,3R,5S)-5-(6-fluoro-5-methyl-2-oxo-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1c(F)cnc2[nH]c(=O)c([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C3O)cc12 |
| InChI | InChI=1S/C14H18FN2O14P3/c1-5-6-2-7(14(20)17-13(6)16-3-8(5)15)12-11(19)10(18)9(29-12)4-28-33(24,25)31-34(26,27)30-32(21,22)23/h2-3,9-12,18-19H,4H2,1H3,(H,24,25)(H,26,27)(H,16,17,20)(H2,21,22,23)/t9-,10+,11?,12+/m1/s1 |
| InChIKey | KXEYBNFUZPFYGU-AIROJPCNSA-N |
| XLogP | -0.12 |
| TPSA | 255.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.22 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|