C13H14F3N2O14P3 — CID 122543317
[[(2R,3R,5S)-3,4-dihydroxy-5-(5,6,7-trifluoro-2-oxo-1H-1,8-naphthyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543317) has the molecular formula C13H14F3N2O14P3 and a molecular weight of 572.17 g/mol. Its IUPAC name is [[(2R,3R,5S)-3,4-dihydroxy-5-(5,6,7-trifluoro-2-oxo-1H-1,8-naphthyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5S)-3,4-dihydroxy-5-(5,6,7-trifluoro-2-oxo-1H-1,8-naphthyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543317 |
| Molecular Formula | C13H14F3N2O14P3 |
| Molecular Weight | 572.17 g/mol |
| Exact Mass | 571.96 |
| IUPAC Name | [[(2R,3R,5S)-3,4-dihydroxy-5-(5,6,7-trifluoro-2-oxo-1H-1,8-naphthyridin-3-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=c1[nH]c2nc(F)c(F)c(F)c2cc1[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C1O |
| InChI | InChI=1S/C13H14F3N2O14P3/c14-6-3-1-4(13(21)18-12(3)17-11(16)7(6)15)10-9(20)8(19)5(30-10)2-29-34(25,26)32-35(27,28)31-33(22,23)24/h1,5,8-10,19-20H,2H2,(H,25,26)(H,27,28)(H,17,18,21)(H2,22,23,24)/t5-,8+,9?,10+/m1/s1 |
| InChIKey | FUZHICLOABLREZ-FALUAKJCSA-N |
| XLogP | -0.15 |
| TPSA | 255.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.17 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|