C15H18F3N2O14P3 — CID 122543391
[[(2R,3R,5S)-3,4-dihydroxy-5-[5-methyl-2-oxo-7-(trifluoromethyl)-1H-1,8-naphthyridin-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543391) has the molecular formula C15H18F3N2O14P3 and a molecular weight of 600.23 g/mol. Its IUPAC name is [[(2R,3R,5S)-3,4-dihydroxy-5-[5-methyl-2-oxo-7-(trifluoromethyl)-1H-1,8-naphthyridin-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5S)-3,4-dihydroxy-5-[5-methyl-2-oxo-7-(trifluoromethyl)-1H-1,8-naphthyridin-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543391 |
| Molecular Formula | C15H18F3N2O14P3 |
| Molecular Weight | 600.23 g/mol |
| Exact Mass | 599.99 |
| IUPAC Name | [[(2R,3R,5S)-3,4-dihydroxy-5-[5-methyl-2-oxo-7-(trifluoromethyl)-1H-1,8-naphthyridin-3-yl]oxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Cc1cc(C(F)(F)F)nc2[nH]c(=O)c([C@@H]3O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[C@H](O)C3O)cc12 |
| InChI | InChI=1S/C15H18F3N2O14P3/c1-5-2-9(15(16,17)18)19-13-6(5)3-7(14(23)20-13)12-11(22)10(21)8(32-12)4-31-36(27,28)34-37(29,30)33-35(24,25)26/h2-3,8,10-12,21-22H,4H2,1H3,(H,27,28)(H,29,30)(H,19,20,23)(H2,24,25,26)/t8-,10+,11?,12+/m1/s1 |
| InChIKey | OLDQFOOWTWNKJK-SONAHEIHSA-N |
| XLogP | 0.76 |
| TPSA | 255.26 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|