C13H16FN2O13P3S — CID 122543335
[[(2R,3R,5S)-5-(5-fluoro-2-sulfanylidene-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 122543335) has the molecular formula C13H16FN2O13P3S and a molecular weight of 552.26 g/mol. Its IUPAC name is [[(2R,3R,5S)-5-(5-fluoro-2-sulfanylidene-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,5S)-5-(5-fluoro-2-sulfanylidene-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 122543335 |
| Molecular Formula | C13H16FN2O13P3S |
| Molecular Weight | 552.26 g/mol |
| Exact Mass | 551.96 |
| IUPAC Name | [[(2R,3R,5S)-5-(5-fluoro-2-sulfanylidene-1H-1,8-naphthyridin-3-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | O=P(O)(O)OP(=O)(O)OP(=O)(O)OC[C@H]1O[C@@H](c2cc3c(F)ccnc3[nH]c2=S)C(O)[C@H]1O |
| InChI | InChI=1S/C13H16FN2O13P3S/c14-7-1-2-15-12-5(7)3-6(13(33)16-12)11-10(18)9(17)8(27-11)4-26-31(22,23)29-32(24,25)28-30(19,20)21/h1-3,8-11,17-18H,4H2,(H,22,23)(H,24,25)(H,15,16,33)(H2,19,20,21)/t8-,9+,10?,11+/m1/s1 |
| InChIKey | VGHJWNJMARGRDZ-BJMCWGGSSA-N |
| XLogP | 0.94 |
| TPSA | 238.19 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|