About 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one
4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one (PubChem CID 122543536) has the molecular formula C10H14FNO
and a molecular weight of 183.23 g/mol. Its IUPAC name is 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one |
| PubChem CID | 122543536 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one |
| SMILES | Cc1[nH]c(=O)c(C)c(F)c1C(C)C |
| InChI | InChI=1S/C10H14FNO/c1-5(2)8-7(4)12-10(13)6(3)9(8)11/h5H,1-4H3,(H,12,13) |
| InChIKey | VEIMLQNQICMMIU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one?
The IUPAC name of 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one (CID 122543536) is 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one.
What is the SMILES notation for 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one?
The canonical SMILES for 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one is Cc1[nH]c(=O)c(C)c(F)c1C(C)C.
What is the InChIKey of 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one?
The InChIKey is VEIMLQNQICMMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FNO/c1-5(2)8-7(4)12-10(13)6(3)9(8)11/h5H,1-4H3,(H,12,13).
What are the key properties of 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one?
4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one has a molecular weight of 183.23 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3,6-dimethyl-5-propan-2-yl-1H-pyridin-2-one is sourced from PubChem (CID 122543536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).