C23H28FN3O3 — CID 122546539
tert-butyl 4-[[4-[(2-fluorobenzoyl)amino]phenyl]methyl]piperazine-1-carboxylate (PubChem CID 122546539) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(2-fluorobenzoyl)amino]phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(2-fluorobenzoyl)amino]phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 122546539 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | tert-butyl 4-[[4-[(2-fluorobenzoyl)amino]phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(NC(=O)c3ccccc3F)cc2)CC1 |
| InChI | InChI=1S/C23H28FN3O3/c1-23(2,3)30-22(29)27-14-12-26(13-15-27)16-17-8-10-18(11-9-17)25-21(28)19-6-4-5-7-20(19)24/h4-11H,12-16H2,1-3H3,(H,25,28) |
| InChIKey | VCLXXMQBUGMLMV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |