C8H17NO3S — CID 122549030
4-methyl-4-(2-methylpropyl)oxathiazinane 2,2-dioxide (PubChem CID 122549030) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is 4-methyl-4-(2-methylpropyl)oxathiazinane 2,2-dioxide.
| Compound Name | 4-methyl-4-(2-methylpropyl)oxathiazinane 2,2-dioxide |
|---|---|
| PubChem CID | 122549030 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 4-methyl-4-(2-methylpropyl)oxathiazinane 2,2-dioxide |
| SMILES | CC(C)CC1(C)CCOS(=O)(=O)N1 |
| InChI | InChI=1S/C8H17NO3S/c1-7(2)6-8(3)4-5-12-13(10,11)9-8/h7,9H,4-6H2,1-3H3 |
| InChIKey | VQSAPTXZUDEZBA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |