C54H58S2 — CID 122550335
2-[2-[5-tert-butyl-2-(7-tert-butylpyren-2-yl)-3-[2-(5-hexylthiophen-2-yl)ethynyl]phenyl]ethynyl]-5-hexylthiophene (PubChem CID 122550335) has the molecular formula C54H58S2 and a molecular weight of 771.19 g/mol. Its IUPAC name is 2-[2-[5-tert-butyl-2-(7-tert-butylpyren-2-yl)-3-[2-(5-hexylthiophen-2-yl)ethynyl]phenyl]ethynyl]-5-hexylthiophene.
| Compound Name | 2-[2-[5-tert-butyl-2-(7-tert-butylpyren-2-yl)-3-[2-(5-hexylthiophen-2-yl)ethynyl]phenyl]ethynyl]-5-hexylthiophene |
|---|---|
| PubChem CID | 122550335 |
| Molecular Formula | C54H58S2 |
| Molecular Weight | 771.19 g/mol |
| Exact Mass | 770.40 |
| IUPAC Name | 2-[2-[5-tert-butyl-2-(7-tert-butylpyren-2-yl)-3-[2-(5-hexylthiophen-2-yl)ethynyl]phenyl]ethynyl]-5-hexylthiophene |
| SMILES | CCCCCCc1ccc(C#Cc2cc(C(C)(C)C)cc(C#Cc3ccc(CCCCCC)s3)c2-c2cc3ccc4cc(C(C)(C)C)cc5ccc(c2)c3c45)s1 |
| InChI | InChI=1S/C54H58S2/c1-9-11-13-15-17-46-27-29-48(55-46)25-23-39-33-44(53(3,4)5)34-40(24-26-49-30-28-47(56-49)18-16-14-12-10-2)50(39)43-31-37-19-21-41-35-45(54(6,7)8)36-42-22-20-38(32-43)51(37)52(41)42/h19-22,27-36H,9-18H2,1-8H3 |
| InChIKey | BCPWHIGDQRMVGI-UHFFFAOYSA-N |
| XLogP | 16.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.19 |
| LogP ≤ 5 | 16.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|