C23H19ClN2O4 — CID 122550447
N-[5-chloro-2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-(4-methylphenoxy)benzamide (PubChem CID 122550447) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[5-chloro-2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-(4-methylphenoxy)benzamide.
| Compound Name | N-[5-chloro-2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-(4-methylphenoxy)benzamide |
|---|---|
| PubChem CID | 122550447 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[5-chloro-2-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]phenyl]-2-(4-methylphenoxy)benzamide |
| SMILES | Cc1ccc(Oc2ccccc2C(=O)Nc2cc(Cl)ccc2/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C23H19ClN2O4/c1-15-6-11-18(12-7-15)30-21-5-3-2-4-19(21)23(28)25-20-14-17(24)10-8-16(20)9-13-22(27)26-29/h2-14,29H,1H3,(H,25,28)(H,26,27)/b13-9+ |
| InChIKey | IGDNSFJHXBPXPD-UKTHLTGXSA-N |
| XLogP | 5.21 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|