C22H18ClFN2O4 — CID 130368938
N-[4-chloro-2-[3-(hydroxyamino)-3-oxopropyl]phenyl]-2-(4-fluorophenoxy)benzamide (PubChem CID 130368938) has the molecular formula C22H18ClFN2O4 and a molecular weight of 428.85 g/mol. Its IUPAC name is N-[4-chloro-2-[3-(hydroxyamino)-3-oxopropyl]phenyl]-2-(4-fluorophenoxy)benzamide.
| Compound Name | N-[4-chloro-2-[3-(hydroxyamino)-3-oxopropyl]phenyl]-2-(4-fluorophenoxy)benzamide |
|---|---|
| PubChem CID | 130368938 |
| Molecular Formula | C22H18ClFN2O4 |
| Molecular Weight | 428.85 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N-[4-chloro-2-[3-(hydroxyamino)-3-oxopropyl]phenyl]-2-(4-fluorophenoxy)benzamide |
| SMILES | O=C(CCc1cc(Cl)ccc1NC(=O)c1ccccc1Oc1ccc(F)cc1)NO |
| InChI | InChI=1S/C22H18ClFN2O4/c23-15-6-11-19(14(13-15)5-12-21(27)26-29)25-22(28)18-3-1-2-4-20(18)30-17-9-7-16(24)8-10-17/h1-4,6-11,13,29H,5,12H2,(H,25,28)(H,26,27) |
| InChIKey | WPOYKUYGFSKBHV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|