C25H29NO3 — CID 122552219
7-methyl-4-[5-[methyl-[(2-methylphenyl)methyl]amino]pentyl]-2-oxochromene-3-carbaldehyde (PubChem CID 122552219) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is 7-methyl-4-[5-[methyl-[(2-methylphenyl)methyl]amino]pentyl]-2-oxochromene-3-carbaldehyde.
| Compound Name | 7-methyl-4-[5-[methyl-[(2-methylphenyl)methyl]amino]pentyl]-2-oxochromene-3-carbaldehyde |
|---|---|
| PubChem CID | 122552219 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 7-methyl-4-[5-[methyl-[(2-methylphenyl)methyl]amino]pentyl]-2-oxochromene-3-carbaldehyde |
| SMILES | Cc1ccc2c(CCCCCN(C)Cc3ccccc3C)c(C=O)c(=O)oc2c1 |
| InChI | InChI=1S/C25H29NO3/c1-18-12-13-22-21(23(17-27)25(28)29-24(22)15-18)11-5-4-8-14-26(3)16-20-10-7-6-9-19(20)2/h6-7,9-10,12-13,15,17H,4-5,8,11,14,16H2,1-3H3 |
| InChIKey | ZLDBANYMTQLMRK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|