C23H25N3O5S2 — CID 122555523
3-[2-[3,5-bis(methanesulfonamido)phenyl]-5-phenylphenyl]propanamide (PubChem CID 122555523) has the molecular formula C23H25N3O5S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is 3-[2-[3,5-bis(methanesulfonamido)phenyl]-5-phenylphenyl]propanamide.
| Compound Name | 3-[2-[3,5-bis(methanesulfonamido)phenyl]-5-phenylphenyl]propanamide |
|---|---|
| PubChem CID | 122555523 |
| Molecular Formula | C23H25N3O5S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | 3-[2-[3,5-bis(methanesulfonamido)phenyl]-5-phenylphenyl]propanamide |
| SMILES | CS(=O)(=O)Nc1cc(NS(C)(=O)=O)cc(-c2ccc(-c3ccccc3)cc2CCC(N)=O)c1 |
| InChI | InChI=1S/C23H25N3O5S2/c1-32(28,29)25-20-13-19(14-21(15-20)26-33(2,30)31)22-10-8-17(16-6-4-3-5-7-16)12-18(22)9-11-23(24)27/h3-8,10,12-15,25-26H,9,11H2,1-2H3,(H2,24,27) |
| InChIKey | FDHMQRGXHROYEL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |