C23H24N2O3 — CID 139454444
3-[2-[3-[[hydroxy(methoxy)methyl]amino]phenyl]-5-phenylphenyl]propanamide (PubChem CID 139454444) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is 3-[2-[3-[[hydroxy(methoxy)methyl]amino]phenyl]-5-phenylphenyl]propanamide.
| Compound Name | 3-[2-[3-[[hydroxy(methoxy)methyl]amino]phenyl]-5-phenylphenyl]propanamide |
|---|---|
| PubChem CID | 139454444 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 3-[2-[3-[[hydroxy(methoxy)methyl]amino]phenyl]-5-phenylphenyl]propanamide |
| SMILES | COC(O)Nc1cccc(-c2ccc(-c3ccccc3)cc2CCC(N)=O)c1 |
| InChI | InChI=1S/C23H24N2O3/c1-28-23(27)25-20-9-5-8-18(15-20)21-12-10-17(16-6-3-2-4-7-16)14-19(21)11-13-22(24)26/h2-10,12,14-15,23,25,27H,11,13H2,1H3,(H2,24,26) |
| InChIKey | HSVDETVXZLRROB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|