C21H17F2NO2 — CID 122555577
3-[2-(2,4-difluoro-3-hydroxyphenyl)-5-phenylphenyl]propanamide (PubChem CID 122555577) has the molecular formula C21H17F2NO2 and a molecular weight of 353.37 g/mol. Its IUPAC name is 3-[2-(2,4-difluoro-3-hydroxyphenyl)-5-phenylphenyl]propanamide.
| Compound Name | 3-[2-(2,4-difluoro-3-hydroxyphenyl)-5-phenylphenyl]propanamide |
|---|---|
| PubChem CID | 122555577 |
| Molecular Formula | C21H17F2NO2 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 3-[2-(2,4-difluoro-3-hydroxyphenyl)-5-phenylphenyl]propanamide |
| SMILES | NC(=O)CCc1cc(-c2ccccc2)ccc1-c1ccc(F)c(O)c1F |
| InChI | InChI=1S/C21H17F2NO2/c22-18-10-9-17(20(23)21(18)26)16-8-6-14(13-4-2-1-3-5-13)12-15(16)7-11-19(24)25/h1-6,8-10,12,26H,7,11H2,(H2,24,25) |
| InChIKey | YVEASBNUFYHCCZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |