About 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid
6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid (PubChem CID 122558950) has the molecular formula C20H20N2O2
and a molecular weight of 320.39 g/mol. Its IUPAC name is 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid |
| PubChem CID | 122558950 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(CN2CCC3(C=Cc4ccccc43)CC2)n1 |
| InChI | InChI=1S/C20H20N2O2/c23-19(24)18-7-3-5-16(21-18)14-22-12-10-20(11-13-22)9-8-15-4-1-2-6-17(15)20/h1-9H,10-14H2,(H,23,24) |
| InChIKey | PJAJOBYIDIDVKC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid?
The IUPAC name of 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid (CID 122558950) is 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid.
What is the SMILES notation for 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid?
The canonical SMILES for 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid is O=C(O)c1cccc(CN2CCC3(C=Cc4ccccc43)CC2)n1.
What is the InChIKey of 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid?
The InChIKey is PJAJOBYIDIDVKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2O2/c23-19(24)18-7-3-5-16(21-18)14-22-12-10-20(11-13-22)9-8-15-4-1-2-6-17(15)20/h1-9H,10-14H2,(H,23,24).
What are the key properties of 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid?
6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid has a molecular weight of 320.39 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(spiro[indene-1,4'-piperidine]-1'-ylmethyl)pyridine-2-carboxylic acid is sourced from PubChem (CID 122558950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).