C19H19N — CID 140556311
1'-phenylspiro[indene-1,4'-piperidine] (PubChem CID 140556311) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 1'-phenylspiro[indene-1,4'-piperidine].
| Compound Name | 1'-phenylspiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 140556311 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 1'-phenylspiro[indene-1,4'-piperidine] |
| SMILES | C1=CC2(CCN(c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C19H19N/c1-2-7-17(8-3-1)20-14-12-19(13-15-20)11-10-16-6-4-5-9-18(16)19/h1-11H,12-15H2 |
| InChIKey | TYHCSQHVASKGJT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |