C22H25NO2 — CID 40554527
1'-[(2,4-dimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] (PubChem CID 40554527) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1'-[(2,4-dimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine].
| Compound Name | 1'-[(2,4-dimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 40554527 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 1'-[(2,4-dimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] |
| SMILES | COc1ccc(CN2CCC3(C=Cc4ccccc43)CC2)c(OC)c1 |
| InChI | InChI=1S/C22H25NO2/c1-24-19-8-7-18(21(15-19)25-2)16-23-13-11-22(12-14-23)10-9-17-5-3-4-6-20(17)22/h3-10,15H,11-14,16H2,1-2H3 |
| InChIKey | IGIUZTABRMASDR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |