C23H27NO3 — CID 30979223
1'-[(2,4,5-trimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] (PubChem CID 30979223) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1'-[(2,4,5-trimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine].
| Compound Name | 1'-[(2,4,5-trimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 30979223 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1'-[(2,4,5-trimethoxyphenyl)methyl]spiro[indene-1,4'-piperidine] |
| SMILES | COc1cc(OC)c(OC)cc1CN1CCC2(C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C23H27NO3/c1-25-20-15-22(27-3)21(26-2)14-18(20)16-24-12-10-23(11-13-24)9-8-17-6-4-5-7-19(17)23/h4-9,14-15H,10-13,16H2,1-3H3 |
| InChIKey | HRPGSHSZVAUYET-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |