C21H20INO2 — CID 44611595
2-(2-iodophenoxy)-1-spiro[indene-1,4'-piperidine]-1'-ylethanone (PubChem CID 44611595) has the molecular formula C21H20INO2 and a molecular weight of 445.30 g/mol. Its IUPAC name is 2-(2-iodophenoxy)-1-spiro[indene-1,4'-piperidine]-1'-ylethanone.
| Compound Name | 2-(2-iodophenoxy)-1-spiro[indene-1,4'-piperidine]-1'-ylethanone |
|---|---|
| PubChem CID | 44611595 |
| Molecular Formula | C21H20INO2 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | 2-(2-iodophenoxy)-1-spiro[indene-1,4'-piperidine]-1'-ylethanone |
| SMILES | O=C(COc1ccccc1I)N1CCC2(C=Cc3ccccc32)CC1 |
| InChI | InChI=1S/C21H20INO2/c22-18-7-3-4-8-19(18)25-15-20(24)23-13-11-21(12-14-23)10-9-16-5-1-2-6-17(16)21/h1-10H,11-15H2 |
| InChIKey | FWSAJRALIGYNNZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|