C16H19FN4O — CID 122559279
N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-5-methyl-2H-triazole-4-carboxamide (PubChem CID 122559279) has the molecular formula C16H19FN4O and a molecular weight of 302.35 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-5-methyl-2H-triazole-4-carboxamide.
| Compound Name | N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-5-methyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 122559279 |
| Molecular Formula | C16H19FN4O |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | N-[[1-(4-fluorophenyl)cyclopentyl]methyl]-5-methyl-2H-triazole-4-carboxamide |
| SMILES | Cc1n[nH]nc1C(=O)NCC1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C16H19FN4O/c1-11-14(20-21-19-11)15(22)18-10-16(8-2-3-9-16)12-4-6-13(17)7-5-12/h4-7H,2-3,8-10H2,1H3,(H,18,22)(H,19,20,21) |
| InChIKey | XWUXSUBGRVLUEH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |