C17H18FN3O — CID 47042253
N-[[1-(4-fluorophenyl)cyclopentyl]methyl]pyrazine-2-carboxamide (PubChem CID 47042253) has the molecular formula C17H18FN3O and a molecular weight of 299.35 g/mol. Its IUPAC name is N-[[1-(4-fluorophenyl)cyclopentyl]methyl]pyrazine-2-carboxamide.
| Compound Name | N-[[1-(4-fluorophenyl)cyclopentyl]methyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 47042253 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N-[[1-(4-fluorophenyl)cyclopentyl]methyl]pyrazine-2-carboxamide |
| SMILES | O=C(NCC1(c2ccc(F)cc2)CCCC1)c1cnccn1 |
| InChI | InChI=1S/C17H18FN3O/c18-14-5-3-13(4-6-14)17(7-1-2-8-17)12-21-16(22)15-11-19-9-10-20-15/h3-6,9-11H,1-2,7-8,12H2,(H,21,22) |
| InChIKey | ULZLZNYVIFORDY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |