C20H28N6O — CID 122561620
3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1-methyl-1-[2-(2-methylindol-1-yl)ethyl]urea (PubChem CID 122561620) has the molecular formula C20H28N6O and a molecular weight of 368.49 g/mol. Its IUPAC name is 3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1-methyl-1-[2-(2-methylindol-1-yl)ethyl]urea.
| Compound Name | 3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1-methyl-1-[2-(2-methylindol-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 122561620 |
| Molecular Formula | C20H28N6O |
| Molecular Weight | 368.49 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 3-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-1-methyl-1-[2-(2-methylindol-1-yl)ethyl]urea |
| SMILES | Cc1nc(C)n(CCCNC(=O)N(C)CCn2c(C)cc3ccccc32)n1 |
| InChI | InChI=1S/C20H28N6O/c1-15-14-18-8-5-6-9-19(18)25(15)13-12-24(4)20(27)21-10-7-11-26-17(3)22-16(2)23-26/h5-6,8-9,14H,7,10-13H2,1-4H3,(H,21,27) |
| InChIKey | MRIDTAZLDRJGTP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|