C20H23N3O — CID 74236302
N-methyl-N-[2-(2-methylindol-1-yl)ethyl]-3-pyridin-4-ylpropanamide (PubChem CID 74236302) has the molecular formula C20H23N3O and a molecular weight of 321.42 g/mol. Its IUPAC name is N-methyl-N-[2-(2-methylindol-1-yl)ethyl]-3-pyridin-4-ylpropanamide.
| Compound Name | N-methyl-N-[2-(2-methylindol-1-yl)ethyl]-3-pyridin-4-ylpropanamide |
|---|---|
| PubChem CID | 74236302 |
| Molecular Formula | C20H23N3O |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-methyl-N-[2-(2-methylindol-1-yl)ethyl]-3-pyridin-4-ylpropanamide |
| SMILES | Cc1cc2ccccc2n1CCN(C)C(=O)CCc1ccncc1 |
| InChI | InChI=1S/C20H23N3O/c1-16-15-18-5-3-4-6-19(18)23(16)14-13-22(2)20(24)8-7-17-9-11-21-12-10-17/h3-6,9-12,15H,7-8,13-14H2,1-2H3 |
| InChIKey | BKUMEAGLODZEQE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |