C13H17F2N3O2 — CID 122562368
1-(3,4-difluorophenyl)-3-[[(3S,4S)-3-hydroxypiperidin-4-yl]methyl]urea (PubChem CID 122562368) has the molecular formula C13H17F2N3O2 and a molecular weight of 285.29 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-[[(3S,4S)-3-hydroxypiperidin-4-yl]methyl]urea.
| Compound Name | 1-(3,4-difluorophenyl)-3-[[(3S,4S)-3-hydroxypiperidin-4-yl]methyl]urea |
|---|---|
| PubChem CID | 122562368 |
| Molecular Formula | C13H17F2N3O2 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-[[(3S,4S)-3-hydroxypiperidin-4-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CCNC[C@H]1O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2N3O2/c14-10-2-1-9(5-11(10)15)18-13(20)17-6-8-3-4-16-7-12(8)19/h1-2,5,8,12,16,19H,3-4,6-7H2,(H2,17,18,20)/t8-,12+/m0/s1 |
| InChIKey | GIDANUNRFFQSCB-QPUJVOFHSA-N |
| XLogP | 1.06 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |