C19H21F2N3O — CID 166237374
1-(4-fluorophenyl)-3-[[(3S,4S)-4-(4-fluorophenyl)piperidin-3-yl]methyl]urea (PubChem CID 166237374) has the molecular formula C19H21F2N3O and a molecular weight of 345.39 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[[(3S,4S)-4-(4-fluorophenyl)piperidin-3-yl]methyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[[(3S,4S)-4-(4-fluorophenyl)piperidin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 166237374 |
| Molecular Formula | C19H21F2N3O |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[[(3S,4S)-4-(4-fluorophenyl)piperidin-3-yl]methyl]urea |
| SMILES | O=C(NC[C@@H]1CNCC[C@@H]1c1ccc(F)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C19H21F2N3O/c20-15-3-1-13(2-4-15)18-9-10-22-11-14(18)12-23-19(25)24-17-7-5-16(21)6-8-17/h1-8,14,18,22H,9-12H2,(H2,23,24,25)/t14-,18+/m0/s1 |
| InChIKey | BXCDPYJCNJAFGZ-KBXCAEBGSA-N |
| XLogP | 3.48 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |