C14H19N3O3S2 — CID 122564218
3,5-dimethyl-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-1,2-oxazole-4-sulfonamide (PubChem CID 122564218) has the molecular formula C14H19N3O3S2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-1,2-oxazole-4-sulfonamide.
| Compound Name | 3,5-dimethyl-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 122564218 |
| Molecular Formula | C14H19N3O3S2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | 3,5-dimethyl-N-[2-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)ethyl]-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCCc1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H19N3O3S2/c1-9-14(10(2)20-17-9)22(18,19)15-8-7-13-16-11-5-3-4-6-12(11)21-13/h15H,3-8H2,1-2H3 |
| InChIKey | UTJPAHFEKVIFCW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |