C16H17NO5 — CID 122564734
4-(2-ethoxy-3-pyridinyl)-3,5-dimethoxybenzoic acid (PubChem CID 122564734) has the molecular formula C16H17NO5 and a molecular weight of 303.31 g/mol. Its IUPAC name is 4-(2-ethoxy-3-pyridinyl)-3,5-dimethoxybenzoic acid.
| Compound Name | 4-(2-ethoxy-3-pyridinyl)-3,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 122564734 |
| Molecular Formula | C16H17NO5 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-(2-ethoxy-3-pyridinyl)-3,5-dimethoxybenzoic acid |
| SMILES | CCOc1ncccc1-c1c(OC)cc(C(=O)O)cc1OC |
| InChI | InChI=1S/C16H17NO5/c1-4-22-15-11(6-5-7-17-15)14-12(20-2)8-10(16(18)19)9-13(14)21-3/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | AQUBHSJUOCTTIY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |