C20H24FN5O — CID 122566085
1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-(1-pyridin-3-ylpentyl)urea (PubChem CID 122566085) has the molecular formula C20H24FN5O and a molecular weight of 369.44 g/mol. Its IUPAC name is 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-(1-pyridin-3-ylpentyl)urea.
| Compound Name | 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-(1-pyridin-3-ylpentyl)urea |
|---|---|
| PubChem CID | 122566085 |
| Molecular Formula | C20H24FN5O |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | 1-[(6-fluoro-1H-benzimidazol-2-yl)methyl]-1-methyl-3-(1-pyridin-3-ylpentyl)urea |
| SMILES | CCCCC(NC(=O)N(C)Cc1nc2ccc(F)cc2[nH]1)c1cccnc1 |
| InChI | InChI=1S/C20H24FN5O/c1-3-4-7-16(14-6-5-10-22-12-14)25-20(27)26(2)13-19-23-17-9-8-15(21)11-18(17)24-19/h5-6,8-12,16H,3-4,7,13H2,1-2H3,(H,23,24)(H,25,27) |
| InChIKey | MJWUQVDMLWOAIV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |